3-(5-Ethylthiophen-2-yl)propan-1-ol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F748551 |
---|---|
Product Name | 3-(5-Ethylthiophen-2-yl)propan-1-ol |
CAS | 1000518-87-5 |
Purity | 95% |
Molecular weight | 170.27 |
IUPAC Name | 3-(5-ethylthiophen-2-yl)propan-1-ol |
SMILES | CCC1=CC=C(CCCO)S1 |
INCHI Code | InChI=1S/C9H14OS/c1-2-8-5-6-9(11-8)4-3-7-10/h5-6,10H,2-4,7H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.9424367 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.5555556 |
Concept Codes | Aliphatic alcohol, Heterocycle, Heteroaromatic, Sulfide, Ethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |