Ethyl 2-amino-5-(tert-butyl)benzoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F742054 |
---|---|
Product Name | Ethyl 2-amino-5-(tert-butyl)benzoate |
CAS | 1179755-40-8 |
Purity | 98% |
Molecular weight | 221.3 |
IUPAC Name | ethyl 2-amino-5-tert-butylbenzoate |
SMILES | CCOC(=O)C1=CC(=CC=C1N)C(C)(C)C |
INCHI Code | InChI=1S/C13H19NO2/c1-5-16-12(15)10-8-9(13(2,3)4)6-7-11(10)14/h6-8H,5,14H2,1-4H3 |
Asymmetric atoms | 0 |
LogP | 3.699661 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.46153846 |
Concept Codes | Phenyl, Ester, Primary amine, Amine (P+S+T), Amino acid ester, Aniline, Cyclic, Aromatic, Benzoate |