Ethyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F741865 |
---|---|
Product Name | Ethyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate |
CAS | 1218662-81-7 |
Purity | 98% |
Molecular weight | 229.227 |
IUPAC Name | ethyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate |
SMILES | CCOC(=O)C(NC)C1=CC(F)=CC=C1F |
INCHI Code | InChI=1/C11H13F2NO2/c1-3-16-11(15)10(14-2)8-6-7(12)4-5-9(8)13/h4-6,10,14H,3H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 2.0096402 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.36363637 |
Concept Codes | Phenyl, Ester, Secondary amine, Amine (P+S+T), Fluoro, Halo, N-methyl, Amino acid ester, 1,4-Difluorobenzene, Difluorobenzene, Cyclic, Aromatic, Alpha-amino acid |