Methyl 2-amino-3-(1h-pyrrol-2-yl)propanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F741089 |
---|---|
Product Name | Methyl 2-amino-3-(1h-pyrrol-2-yl)propanoate |
CAS | 1343628-31-8 |
Purity | 98% |
Molecular weight | 168.196 |
IUPAC Name | methyl 2-amino-3-(1H-pyrrol-2-yl)propanoate |
SMILES | COC(=O)C(N)CC1=CC=CN1 |
INCHI Code | InChI=1/C8H12N2O2/c1-12-8(11)7(9)5-6-3-2-4-10-6/h2-4,7,10H,5,9H2,1H3 |
Asymmetric atoms | 1 |
LogP | -0.0053071207 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.375 |
Concept Codes | Ester, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Amino acid ester, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrrole, Cyclic, Aromatic, Alpha-amino acid |