3-(2,3-Difluorophenyl)-2-methylpropanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F738617 |
---|---|
Product Name | 3-(2,3-Difluorophenyl)-2-methylpropanoic acid |
CAS | 1250203-60-1 |
Purity | 98% |
Molecular weight | 200.185 |
IUPAC Name | 3-(2,3-difluorophenyl)-2-methylpropanoic acid |
SMILES | CC(CC1=CC=CC(F)=C1F)C(O)=O |
INCHI Code | InChI=1/C10H10F2O2/c1-6(10(13)14)5-7-3-2-4-8(11)9(7)12/h2-4,6H,5H2,1H3,(H,13,14) |
Asymmetric atoms | 1 |
LogP | 2.8839529 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Carboxylic acid, Fluoro, Halo, 1,2-Difluorobenzene, Difluorobenzene, Cyclic, Aromatic |