(1S,5R)-5-Boc-amino-cyclohex-3-enecarboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F736814 |
---|---|
Product Name | (1S,5R)-5-Boc-amino-cyclohex-3-enecarboxylic acid |
CAS | 1932033-21-0 |
Purity | 98% |
Molecular weight | 241.287 |
IUPAC Name | (1S,5R)-5-{[(tert-butoxy)carbonyl]amino}cyclohex-3-ene-1-carboxylic acid |
SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC=C1)C(O)=O |
INCHI Code | InChI=1/C12H19NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h4,6,8-9H,5,7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9-/s2 |
Asymmetric atoms | 2 |
LogP | 1.6826394 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.6666667 |
Concept Codes | Carboxylic acid, Secondary amine, Amine (P+S+T), Chiral, NBOC, Carbamate, Amino acid, Chiral carboxylic acid, Cyclic, Cyclohexene |