1-(3-Chloro-2-methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F735433 |
---|---|
Product Name | 1-(3-Chloro-2-methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid |
CAS | 1042534-76-8 |
Purity | 97% |
Molecular weight | 237.64 |
IUPAC Name | 1-(3-chloro-2-methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid |
SMILES | CC1=C(Cl)C=CC=C1N1C=C(N=N1)C(O)=O |
INCHI Code | InChI=1S/C10H8ClN3O2/c1-6-7(11)3-2-4-9(6)14-5-8(10(15)16)12-13-14/h2-5H,1H3,(H,15,16) |
Asymmetric atoms | 0 |
LogP | 2.8390877 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.1 |
Concept Codes | Phenyl, Carboxylic acid, Heterocycle, Heteroaromatic, Chloro, Halo, Methyl, Tolyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Disubstituted (2,3)- monochlorobenzene, Monochlorobenzene, Cyclic, Aromatic, 1,2,3-Triazole |