5-Methyl-1H-indole-6-carbonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F735068 |
---|---|
Product Name | 5-Methyl-1H-indole-6-carbonitrile |
CAS | 1167056-69-0 |
Purity | 95+% |
Molecular weight | 156.188 |
IUPAC Name | 5-methyl-1H-indole-6-carbonitrile |
SMILES | CC1=C(C=C2NC=CC2=C1)C#N |
INCHI Code | InChI=1S/C10H8N2/c1-7-4-8-2-3-12-10(8)5-9(7)6-11/h2-5,12H,1H3 |
Asymmetric atoms | 0 |
LogP | 2.4415255 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.1 |
Concept Codes | Heterocycle, Heteroaromatic, Nitrile, Methyl, Tolyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Indole, Cyclic, Aromatic |