2-(2-Methoxyethoxy)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F733954 |
---|---|
Product Name | 2-(2-Methoxyethoxy)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
CAS | 1354712-71-2 |
Purity | 95+% |
Molecular weight | 293.17 |
IUPAC Name | 2-(2-methoxyethoxy)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
SMILES | COCCOC1=NC=C(C=C1C)B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C15H24BNO4/c1-11-9-12(10-17-13(11)19-8-7-18-6)16-20-14(2,3)15(4,5)21-16/h9-10H,7-8H2,1-6H3 |
Asymmetric atoms | 0 |
LogP | 3.3368 |
H bond acceptors | 5 |
H bond donors | 0 |
fsp3 | 0.6666667 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Methyl, Boronic ester, Pinacol boronate, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic, 1,3,2-Dioxaborolane, PEG-2 |