N-(2,6-difluorophenyl)hydrazinecarboxamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F731371 |
---|---|
Product Name | N-(2,6-difluorophenyl)hydrazinecarboxamide |
Other Names | N-(2,6-Difluorophenyl)-1-hydrazinecarboxamide |
CAS | 171277-87-5 |
Purity | 95+% |
Molecular weight | 187.15 |
IUPAC Name | 3-amino-1-(2,6-difluorophenyl)urea |
SMILES | NNC(=O)NC1=C(F)C=CC=C1F |
INCHI Code | InChI=1S/C7H7F2N3O/c8-4-2-1-3-5(9)6(4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13) |
Asymmetric atoms | 0 |
LogP | 0.86633885 |
H bond acceptors | 2 |
H bond donors | 3 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Fluoro, Halo, Semicarbazide, 1,3-Difluorobenzene, Difluorobenzene, Cyclic, Aromatic |