2-(Difluoromethyl)-4-fluoro-1-(trifluoromethyl)benzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F728168 |
---|---|
Product Name | 2-(Difluoromethyl)-4-fluoro-1-(trifluoromethyl)benzene |
CAS | 1214358-19-6 |
Purity | 95+% |
Molecular weight | 214.11 |
IUPAC Name | 2-(difluoromethyl)-4-fluoro-1-(trifluoromethyl)benzene |
SMILES | FC(F)C1=C(C=CC(F)=C1)C(F)(F)F |
INCHI Code | InChI=1S/C8H4F6/c9-4-1-2-6(8(12,13)14)5(3-4)7(10)11/h1-3,7H |
Asymmetric atoms | 0 |
LogP | 3.3828843 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Fluoro, Halo, Trifluoromethyl, Difluoromethyl, Difluoromethyl/difluoromethoxy benzene, Disubstituted (3,4)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, PFA01, PFA02 |