2,2,2-Trichloroethyl 3,5-dihydroxybenzoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F727818 |
---|---|
Product Name | 2,2,2-Trichloroethyl 3,5-dihydroxybenzoate |
CAS | 143330-91-0 |
Purity | 98+% |
Molecular weight | 285.5 |
IUPAC Name | 2,2,2-trichloroethyl 3,5-dihydroxybenzoate |
SMILES | OC1=CC(=CC(O)=C1)C(=O)OCC(Cl)(Cl)Cl |
INCHI Code | InChI=1S/C9H7Cl3O4/c10-9(11,12)4-16-8(15)5-1-6(13)3-7(14)2-5/h1-3,13-14H,4H2 |
Asymmetric atoms | 0 |
LogP | 2.9447482 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Ester, Chloro, Halo, Aromatic alcohol, Phenol, Cyclic, Aromatic, Benzoate |