2-Ethyl-1-((2-nitrophenyl)sulfonyl)piperidine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F727222 |
---|---|
Product Name | 2-Ethyl-1-((2-nitrophenyl)sulfonyl)piperidine |
CAS | 331256-11-2 |
Purity | 90% |
Molecular weight | 298.36 |
IUPAC Name | 2-ethyl-1-(2-nitrobenzenesulfonyl)piperidine |
SMILES | CCC1CCCCN1S(=O)(=O)C1=CC=CC=C1[N+]([O-])=O |
INCHI Code | InChI=1/C13H18N2O4S/c1-2-11-7-5-6-10-14(11)20(18,19)13-9-4-3-8-12(13)15(16)17/h3-4,8-9,11H,2,5-7,10H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.7560766 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.53846157 |
Concept Codes | Phenyl, Heterocycle, Nitro, Sulfonamide, Ethyl, 6-Membered heterocycle, Piperidine, Nitrobenzene, Cyclic, Aromatic |