Ethyl 4-ethylthiazole-2-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F721088 |
---|---|
Product Name | Ethyl 4-ethylthiazole-2-carboxylate |
CAS | 79247-88-4 |
Purity | 96% |
Molecular weight | 185.24 |
IUPAC Name | ethyl 4-ethyl-1,3-thiazole-2-carboxylate |
SMILES | CCOC(=O)C1=NC(CC)=CS1 |
INCHI Code | InChI=1S/C8H11NO2S/c1-3-6-5-12-7(9-6)8(10)11-4-2/h5H,3-4H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.0017743 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Ester, Heterocycle, Heteroaromatic, Sulfide, Ethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiazole, Cyclic, Aromatic |