Methyl 3,4-dichloro-5-nitrobenzoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F719868 |
---|---|
Product Name | Methyl 3,4-dichloro-5-nitrobenzoate |
CAS | 63105-53-3 |
Purity | 95% |
Molecular weight | 250.03 |
IUPAC Name | methyl 3,4-dichloro-5-nitrobenzoate |
SMILES | COC(=O)C1=CC(Cl)=C(Cl)C(=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C8H5Cl2NO4/c1-15-8(12)4-2-5(9)7(10)6(3-4)11(13)14/h2-3H,1H3 |
Asymmetric atoms | 0 |
LogP | 3.1247964 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Ester, Nitro, Chloro, Halo, 1,2-Dichlorobenzene, Dichlorobenzene, Nitrobenzene, Cyclic, Aromatic, Benzoate, 1-Chloro-2-nitrobenzene, 1-Halo-2-nitrobenzene |