1-(4,5-Dimethyl-4h-1,2,4-triazol-3-yl)-3-(methylsulfonyl)propan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F717179 |
---|---|
Product Name | 1-(4,5-Dimethyl-4h-1,2,4-triazol-3-yl)-3-(methylsulfonyl)propan-1-amine |
CAS | 1248823-56-4 |
Purity | 98% |
Molecular weight | 232.3 |
IUPAC Name | 1-(4,5-dimethyl-4H-1,2,4-triazol-3-yl)-3-methanesulfonylpropan-1-amine |
SMILES | CN1C(C)=NN=C1C(N)CCS(C)(=O)=O |
INCHI Code | InChI=1/C8H16N4O2S/c1-6-10-11-8(12(6)2)7(9)4-5-15(3,13)14/h7H,4-5,9H2,1-3H3 |
Asymmetric atoms | 1 |
LogP | -2.6083915 |
H bond acceptors | 5 |
H bond donors | 1 |
fsp3 | 0.75 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfone, Methyl, N-methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,2,4-Triazole |