2-(2,4-Difluorophenyl)-1-(1-methyl-1h-pyrazol-3-yl)ethan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F717177 |
---|---|
Product Name | 2-(2,4-Difluorophenyl)-1-(1-methyl-1h-pyrazol-3-yl)ethan-1-amine |
CAS | 1484432-56-5 |
Purity | 98% |
Molecular weight | 237.254 |
IUPAC Name | 2-(2,4-difluorophenyl)-1-(1-methyl-1H-pyrazol-3-yl)ethan-1-amine |
SMILES | CN1C=CC(=N1)C(N)CC1=CC=C(F)C=C1F |
INCHI Code | InChI=1/C12H13F2N3/c1-17-5-4-12(16-17)11(15)6-8-2-3-9(13)7-10(8)14/h2-5,7,11H,6,15H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.1188407 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Fluoro, Halo, N-methyl, 1,3-Difluorobenzene, 5-Membered heteroaromatic, 5-Membered heterocycle, Difluorobenzene, Pyrazole, Cyclic, Aromatic |