2-Iodo-N-(pyridin-3-ylmethyl)aniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F715747 |
---|---|
Product Name | 2-Iodo-N-(pyridin-3-ylmethyl)aniline |
CAS | 1152561-11-9 |
Purity | 98% |
Molecular weight | 310.138 |
IUPAC Name | 2-iodo-N-[(pyridin-3-yl)methyl]aniline |
SMILES | IC1=CC=CC=C1NCC1=CC=CN=C1 |
INCHI Code | InChI=1S/C12H11IN2/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10/h1-8,15H,9H2 |
Asymmetric atoms | 0 |
LogP | 2.8817692 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.083333336 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Iodo, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Monoiodobenzenes, Monosubstituted (ortho) monoiodobenzene, Pyridine, Cyclic, Aromatic |