2-(4-Fluorophenyl)-4-(piperazin-1-ylmethyl)thiazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F715458 |
---|---|
Product Name | 2-(4-Fluorophenyl)-4-(piperazin-1-ylmethyl)thiazole |
CAS | 923754-14-7 |
Purity | 98% |
Molecular weight | 277.36 |
IUPAC Name | 1-{[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl}piperazine |
SMILES | FC1=CC=C(C=C1)C1=NC(CN2CCNCC2)=CS1 |
INCHI Code | InChI=1S/C14H16FN3S/c15-12-3-1-11(2-4-12)14-17-13(10-19-14)9-18-7-5-16-6-8-18/h1-4,10,16H,5-9H2 |
Asymmetric atoms | 0 |
LogP | 2.286451 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.35714287 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Secondary amine, Tertiary amine, Amine (P+S+T), Sulfide, Fluoro, Halo, Diamine, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Monofluorobenzene, Monosubstituted (para) monofluorobenzene, Piperazine, Thiazole, Cyclic, Aromatic |