2-(1,3-Dimethyl-1h-pyrazol-5-yl)-N-methylethan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F713240 |
---|---|
Product Name | 2-(1,3-Dimethyl-1h-pyrazol-5-yl)-N-methylethan-1-amine |
CAS | 1531560-22-1 |
Purity | 98% |
Molecular weight | 153.229 |
IUPAC Name | [2-(1,3-dimethyl-1H-pyrazol-5-yl)ethyl](methyl)amine |
SMILES | CNCCC1=CC(C)=NN1C |
INCHI Code | InChI=1S/C8H15N3/c1-7-6-8(4-5-9-2)11(3)10-7/h6,9H,4-5H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 0.07078574 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.625 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Methyl, N-methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Cyclic, Aromatic |