2-((1-Methyl-1h-pyrazol-4-yl)methoxy)pyridin-3-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F712423 |
---|---|
Product Name | 2-((1-Methyl-1h-pyrazol-4-yl)methoxy)pyridin-3-amine |
Other Names | 2-(1-Methyl-1H-pyrazol-4-ylmethoxy)-pyridin-3-ylamine |
CAS | 1006464-64-7 |
Purity | 95% |
Molecular weight | 204.233 |
IUPAC Name | 2-[(1-methyl-1H-pyrazol-4-yl)methoxy]pyridin-3-amine |
SMILES | CN1C=C(COC2=C(N)C=CC=N2)C=N1 |
INCHI Code | InChI=1S/C10H12N4O/c1-14-6-8(5-13-14)7-15-10-9(11)3-2-4-12-10/h2-6H,7,11H2,1H3 |
Asymmetric atoms | 0 |
LogP | 0.51576686 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.2 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), N-methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrazole, Pyridine, Cyclic, Aromatic |