n-(Sec-butyl)-2-chloroaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F711909 |
---|---|
Product Name | n-(Sec-butyl)-2-chloroaniline |
CAS | 1019552-39-6 |
Purity | 95% |
Molecular weight | 183.68 |
IUPAC Name | N-(butan-2-yl)-2-chloroaniline |
SMILES | CCC(C)NC1=CC=CC=C1Cl |
INCHI Code | InChI=1/C10H14ClN/c1-3-8(2)12-10-7-5-4-6-9(10)11/h4-8,12H,3H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 3.345974 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Chloro, Halo, Monochlorobenzene, Monosubstituted (ortho) monochlorobenzene, Cyclic, Aromatic |