2-(2,4,6-Trimethylbenzyl)butanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F709029 |
---|---|
Product Name | 2-(2,4,6-Trimethylbenzyl)butanoic acid |
CAS | 1247527-94-1 |
Purity | 98% |
Molecular weight | 220.312 |
IUPAC Name | 2-[(2,4,6-trimethylphenyl)methyl]butanoic acid |
SMILES | CCC(CC1=C(C)C=C(C)C=C1C)C(O)=O |
INCHI Code | InChI=1/C14H20O2/c1-5-12(14(15)16)8-13-10(3)6-9(2)7-11(13)4/h6-7,12H,5,8H2,1-4H3,(H,15,16) |
Asymmetric atoms | 1 |
LogP | 4.5833817 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Carboxylic acid, Methyl, Tolyl, Cyclic, Aromatic |