(5-Methyl-1,2,4-oxadiazol-3-yl)(piperazin-1-yl)methanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F706729 |
---|---|
Product Name | (5-Methyl-1,2,4-oxadiazol-3-yl)(piperazin-1-yl)methanone |
CAS | 1040057-14-4 |
Purity | 95% |
Molecular weight | 196.21 |
IUPAC Name | 1-(5-methyl-1,2,4-oxadiazole-3-carbonyl)piperazine |
SMILES | CC1=NC(=NO1)C(=O)N1CCNCC1 |
INCHI Code | InChI=1S/C8H12N4O2/c1-6-10-7(11-14-6)8(13)12-4-2-9-3-5-12/h9H,2-5H2,1H3 |
Asymmetric atoms | 0 |
LogP | -0.6317427 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.625 |
Concept Codes | Heterocycle, Heteroaromatic, Amide, Secondary amine, Amine (P+S+T), Methyl, 1,2,4-Oxadiazole, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Piperazine, Cyclic, Aromatic, Oxadiazole |