2-Amino-2-methyl-4-(3,4,5-trimethyl-1h-pyrazol-1-yl)butanamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F705627 |
---|---|
Product Name | 2-Amino-2-methyl-4-(3,4,5-trimethyl-1h-pyrazol-1-yl)butanamide |
CAS | 1247108-48-0 |
Purity | 98% |
Molecular weight | 224.308 |
IUPAC Name | 2-amino-2-methyl-4-(3,4,5-trimethyl-1H-pyrazol-1-yl)butanamide |
SMILES | CC1=NN(CCC(C)(N)C(N)=O)C(C)=C1C |
INCHI Code | InChI=1/C11H20N4O/c1-7-8(2)14-15(9(7)3)6-5-11(4,13)10(12)16/h5-6,13H2,1-4H3,(H2,12,16) |
Asymmetric atoms | 1 |
LogP | -0.17580244 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.6363636 |
Concept Codes | Heterocycle, Heteroaromatic, Amide, Primary amine, Amine (P+S+T), Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Cyclic, Aromatic |