2-Cyclobutylcyclopropane-1-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F704477 |
---|---|
Product Name | 2-Cyclobutylcyclopropane-1-carboxylic acid |
CAS | 1376237-98-7 |
Purity | 98% |
Molecular weight | 140.182 |
IUPAC Name | 2-cyclobutylcyclopropane-1-carboxylic acid |
SMILES | OC(=O)C1CC1C1CCC1 |
INCHI Code | InChI=1/C8H12O2/c9-8(10)7-4-6(7)5-2-1-3-5/h5-7H,1-4H2,(H,9,10) |
Asymmetric atoms | 2 |
LogP | 1.5559001 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.875 |
Concept Codes | Carboxylic acid, Cyclobutane, Cyclic, Cyclopropane |