2-(Ethylthio)-1-(3-fluoro-4-methoxyphenyl)ethan-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F703174 |
---|---|
Product Name | 2-(Ethylthio)-1-(3-fluoro-4-methoxyphenyl)ethan-1-one |
CAS | 1157221-25-4 |
Purity | 98% |
Molecular weight | 228.28 |
IUPAC Name | 2-(ethylsulfanyl)-1-(3-fluoro-4-methoxyphenyl)ethan-1-one |
SMILES | CCSCC(=O)C1=CC=C(OC)C(F)=C1 |
INCHI Code | InChI=1S/C11H13FO2S/c1-3-15-7-10(13)8-4-5-11(14-2)9(12)6-8/h4-6H,3,7H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.3825285 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.36363637 |
Concept Codes | Phenyl, Ketone, Methoxy, Ether, Sulfide, Fluoro, Halo, Disubstituted (2,5)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Anisole |