2,2,2-Trifluoro-1-(2-fluoro-5-methylphenyl)ethan-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F702636 |
---|---|
Product Name | 2,2,2-Trifluoro-1-(2-fluoro-5-methylphenyl)ethan-1-one |
CAS | 1341984-01-7 |
Purity | 98% |
Molecular weight | 206.14 |
IUPAC Name | 2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)ethan-1-one |
SMILES | CC1=CC=C(F)C(=C1)C(=O)C(F)(F)F |
INCHI Code | InChI=1S/C9H6F4O/c1-5-2-3-7(10)6(4-5)8(14)9(11,12)13/h2-4H,1H3 |
Asymmetric atoms | 0 |
LogP | 3.3193452 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Ketone, Fluoro, Halo, Methyl, Trifluoromethyl, Tolyl, Disubstituted (2,4)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Trifluoroacetophenone, PFA01, PFA02 |