5-Methyl-1-(2,2,2-trifluoroethyl)-1h-1,2,3-triazole-4-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F702017 |
---|---|
Product Name | 5-Methyl-1-(2,2,2-trifluoroethyl)-1h-1,2,3-triazole-4-carboxylic acid |
CAS | 1248712-59-5 |
Purity | 95% |
Molecular weight | 209.128 |
IUPAC Name | 5-methyl-1-(2,2,2-trifluoroethyl)-1H-1,2,3-triazole-4-carboxylic acid |
SMILES | CC1=C(N=NN1CC(F)(F)F)C(O)=O |
INCHI Code | InChI=1S/C6H6F3N3O2/c1-3-4(5(13)14)10-11-12(3)2-6(7,8)9/h2H2,1H3,(H,13,14) |
Asymmetric atoms | 0 |
LogP | 1.2183208 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Fluoro, Halo, Methyl, Trifluoromethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,2,3-Triazole, PFA01, PFA02 |