3-(4-Methyl-3-nitrophenyl)-1h-pyrazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F700683 |
---|---|
Product Name | 3-(4-Methyl-3-nitrophenyl)-1h-pyrazole |
CAS | 1249978-17-3 |
Purity | 98% |
Molecular weight | 203.201 |
IUPAC Name | 3-(4-methyl-3-nitrophenyl)-1H-pyrazole |
SMILES | CC1=CC=C(C=C1[N+]([O-])=O)C1=NNC=C1 |
INCHI Code | InChI=1S/C10H9N3O2/c1-7-2-3-8(6-10(7)13(14)15)9-4-5-11-12-9/h2-6H,1H3,(H,11,12) |
Asymmetric atoms | 0 |
LogP | 2.763911 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.1 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Nitro, Methyl, Tolyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Nitrobenzene, Cyclic, Aromatic |