(2-(5-Bromofuran-2-yl)cyclopropyl)methanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F699977 |
---|---|
Product Name | (2-(5-Bromofuran-2-yl)cyclopropyl)methanamine |
CAS | 1408131-19-0 |
Purity | 98% |
Molecular weight | 216.078 |
IUPAC Name | 1-[2-(5-bromofuran-2-yl)cyclopropyl]methanamine |
SMILES | NCC1CC1C1=CC=C(Br)O1 |
INCHI Code | InChI=1/C8H10BrNO/c9-8-2-1-7(11-8)6-3-5(6)4-10/h1-2,5-6H,3-4,10H2 |
Asymmetric atoms | 2 |
LogP | 1.0273426 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Bromo, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic, Cyclopropane |