2-(5-Bromothiophen-2-yl)-2-ethoxyethan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F699511 |
---|---|
Product Name | 2-(5-Bromothiophen-2-yl)-2-ethoxyethan-1-amine |
CAS | 1248699-62-8 |
Purity | 98% |
Molecular weight | 250.15 |
IUPAC Name | 2-(5-bromothiophen-2-yl)-2-ethoxyethan-1-amine |
SMILES | CCOC(CN)C1=CC=C(Br)S1 |
INCHI Code | InChI=1/C8H12BrNOS/c1-2-11-6(5-10)7-3-4-8(9)12-7/h3-4,6H,2,5,10H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.3162436 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, Bromo, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |