8-Ethylquinolin-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F698571 |
---|---|
Product Name | 8-Ethylquinolin-2-amine |
CAS | 104217-17-6 |
Purity | 95% |
Molecular weight | 172.231 |
IUPAC Name | 8-ethylquinolin-2-amine |
SMILES | CCC1=C2N=C(N)C=CC2=CC=C1 |
INCHI Code | InChI=1S/C11H12N2/c1-2-8-4-3-5-9-6-7-10(12)13-11(8)9/h3-7H,2H2,1H3,(H2,12,13) |
Asymmetric atoms | 0 |
LogP | 2.854422 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.18181819 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Ethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Quinoline, Cyclic, Aromatic |