4-(5-Chlorothiophen-2-yl)-1h-imidazol-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F698350 |
---|---|
Product Name | 4-(5-Chlorothiophen-2-yl)-1h-imidazol-2-amine |
CAS | 1215910-31-8 |
Purity | 98% |
Molecular weight | 199.66 |
IUPAC Name | 4-(5-chlorothiophen-2-yl)-1H-imidazol-2-amine |
SMILES | NC1=NC(=CN1)C1=CC=C(Cl)S1 |
INCHI Code | InChI=1S/C7H6ClN3S/c8-6-2-1-5(12-6)4-3-10-7(9)11-4/h1-3H,(H3,9,10,11) |
Asymmetric atoms | 0 |
LogP | 2.2903643 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, Chloro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Imidazole, Thiophene, Cyclic, Aromatic |