1-((4-Methyl-4h-1,2,4-triazol-3-yl)methyl)-1h-pyrazol-4-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F698206 |
---|---|
Product Name | 1-((4-Methyl-4h-1,2,4-triazol-3-yl)methyl)-1h-pyrazol-4-amine |
CAS | 1248671-81-9 |
Purity | 95% |
Molecular weight | 178.199 |
IUPAC Name | 1-[(4-methyl-4H-1,2,4-triazol-3-yl)methyl]-1H-pyrazol-4-amine |
SMILES | CN1C=NN=C1CN1C=C(N)C=N1 |
INCHI Code | InChI=1S/C7H10N6/c1-12-5-9-11-7(12)4-13-3-6(8)2-10-13/h2-3,5H,4,8H2,1H3 |
Asymmetric atoms | 0 |
LogP | -1.4854262 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.2857143 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), N-methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Cyclic, Aromatic, 1,2,4-Triazole |