1-(3,5-Dimethylcyclohexyl)-2-methylpiperazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F697268 |
---|---|
Product Name | 1-(3,5-Dimethylcyclohexyl)-2-methylpiperazine |
CAS | 1339440-61-7 |
Purity | 98% |
Molecular weight | 210.365 |
IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-methylpiperazine |
SMILES | CC1CC(C)CC(C1)N1CCNCC1C |
INCHI Code | InChI=1/C13H26N2/c1-10-6-11(2)8-13(7-10)15-5-4-14-9-12(15)3/h10-14H,4-9H2,1-3H3 |
Asymmetric atoms | 3 |
LogP | 2.444125 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Secondary amine, Tertiary amine, Amine (P+S+T), Methyl, Diamine, 6-Membered heterocycle, Piperazine, Cyclohexane, Cyclic |