2-Ethynyl-5-methoxypyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F695167 |
---|---|
Product Name | 2-Ethynyl-5-methoxypyridine |
CAS | 1196155-18-6 |
Purity | 97% |
Molecular weight | 133.15 |
IUPAC Name | 2-ethynyl-5-methoxypyridine |
SMILES | COC1=CN=C(C=C1)C#C |
INCHI Code | InChI=1S/C8H7NO/c1-3-7-4-5-8(10-2)6-9-7/h1,4-6H,2H3 |
Asymmetric atoms | 0 |
LogP | 1.1345878 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Alkyne, Methoxy, Terminal alkyne, Ether, Heterocycle, Heteroaromatic, Terminal alkyne (aliphatic hydrocarbon), Terminal alkyne (aromatic hydrocarbon), Terminal alkyne (heteroaromatic), 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |