Cyclopropyl(3-(trifluoromethyl)phenyl)methanamine hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F693040 |
---|---|
Product Name | Cyclopropyl(3-(trifluoromethyl)phenyl)methanamine hydrochloride |
Other Names | Cyclopropyl(3-(trifluoromethyl)phenyl)methanaminehydrochloride |
CAS | 2138165-87-2 |
Purity | 97% |
Molecular weight | 251.68 |
IUPAC Name | 1-cyclopropyl-1-[3-(trifluoromethyl)phenyl]methanamine hydrochloride |
SMILES | Cl.NC(C1CC1)C1=CC(=CC=C1)C(F)(F)F |
INCHI Code | InChI=1/C11H12F3N.ClH/c12-11(13,14)9-3-1-2-8(6-9)10(15)7-4-5-7;/h1-3,6-7,10H,4-5,15H2;1H |
Asymmetric atoms | 1 |
LogP | 2.817207 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.45454547 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Fluoro, Halo, Trifluoromethyl, Hydrochloride, Monosubstituted (meta) trifluoromethylbenzene, Cyclic, Aromatic, Cyclopropane, PFA01, PFA02 |