5-Methoxy-2-methyl-3-nitropyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F690277 |
---|---|
Product Name | 5-Methoxy-2-methyl-3-nitropyridine |
CAS | 1211534-67-6 |
Purity | 97% |
Molecular weight | 168.152 |
IUPAC Name | 5-methoxy-2-methyl-3-nitropyridine |
SMILES | COC1=CC(=C(C)N=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C7H8N2O3/c1-5-7(9(10)11)3-6(12-2)4-8-5/h3-4H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 0.6692565 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.2857143 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Nitro, Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |