n-Methyl-1-(4,5,6-trimethylpyrimidin-2-yl)methanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F688965 |
---|---|
Product Name | n-Methyl-1-(4,5,6-trimethylpyrimidin-2-yl)methanamine |
CAS | 1343343-59-8 |
Purity | 95% |
Molecular weight | 165.24 |
IUPAC Name | methyl[(4,5,6-trimethylpyrimidin-2-yl)methyl]amine |
SMILES | CNCC1=NC(C)=C(C)C(C)=N1 |
INCHI Code | InChI=1S/C9H15N3/c1-6-7(2)11-9(5-10-4)12-8(6)3/h10H,5H2,1-4H3 |
Asymmetric atoms | 0 |
LogP | 0.93839306 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.5555556 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Methyl, N-methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Cyclic, Aromatic |