4-Methoxy-N-(1-(thiophen-2-yl)ethyl)butan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F685705 |
---|---|
Product Name | 4-Methoxy-N-(1-(thiophen-2-yl)ethyl)butan-1-amine |
CAS | 1250109-21-7 |
Purity | 95% |
Molecular weight | 213.34 |
IUPAC Name | (4-methoxybutyl)[1-(thiophen-2-yl)ethyl]amine |
SMILES | COCCCCNC(C)C1=CC=CS1 |
INCHI Code | InChI=1/C11H19NOS/c1-10(11-6-5-9-14-11)12-7-3-4-8-13-2/h5-6,9-10,12H,3-4,7-8H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 2.391398 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.6363636 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Sulfide, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |