2-((2,4,6-Trimethylbenzyl)amino)propan-1-ol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F685362 |
---|---|
Product Name | 2-((2,4,6-Trimethylbenzyl)amino)propan-1-ol |
CAS | 1153894-17-7 |
Purity | 95% |
Molecular weight | 207.317 |
IUPAC Name | 2-{[(2,4,6-trimethylphenyl)methyl]amino}propan-1-ol |
SMILES | CC(CO)NCC1=C(C)C=C(C)C=C1C |
INCHI Code | InChI=1/C13H21NO/c1-9-5-10(2)13(11(3)6-9)7-14-12(4)8-15/h5-6,12,14-15H,7-8H2,1-4H3 |
Asymmetric atoms | 1 |
LogP | 2.7983317 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.53846157 |
Concept Codes | Phenyl, Aliphatic alcohol, Secondary amine, Amine (P+S+T), Methyl, Tolyl, Cyclic, Aromatic |