2-Methyl-N-(pentan-2-yl)pyridin-3-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F685113 |
---|---|
Product Name | 2-Methyl-N-(pentan-2-yl)pyridin-3-amine |
CAS | 1542409-62-0 |
Purity | 95% |
Molecular weight | 178.279 |
IUPAC Name | 2-methyl-N-(pentan-2-yl)pyridin-3-amine |
SMILES | CCCC(C)NC1=CC=CN=C1C |
INCHI Code | InChI=1/C11H18N2/c1-4-6-9(2)13-11-7-5-8-12-10(11)3/h5,7-9,13H,4,6H2,1-3H3 |
Asymmetric atoms | 1 |
LogP | 2.1001956 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.54545456 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |