2-(4-(Trifluoromethyl)thiazol-2-yl)butan-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F684276 |
---|---|
Product Name | 2-(4-(Trifluoromethyl)thiazol-2-yl)butan-2-amine |
CAS | 1249000-84-7 |
Purity | 98% |
Molecular weight | 224.25 |
IUPAC Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine |
SMILES | CCC(C)(N)C1=NC(=CS1)C(F)(F)F |
INCHI Code | InChI=1/C8H11F3N2S/c1-3-7(2,12)6-13-5(4-14-6)8(9,10)11/h4H,3,12H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 2.6187248 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.625 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, Fluoro, Halo, Trifluoromethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiazole, Cyclic, Aromatic, PFA01, PFA02 |