1-Isobutyl-2-isopropylpiperazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F683665 |
---|---|
Product Name | 1-Isobutyl-2-isopropylpiperazine |
CAS | 1267461-71-1 |
Purity | 95% |
Molecular weight | 184.327 |
IUPAC Name | 1-(2-methylpropyl)-2-(propan-2-yl)piperazine |
SMILES | CC(C)CN1CCNCC1C(C)C |
INCHI Code | InChI=1/C11H24N2/c1-9(2)8-13-6-5-12-7-11(13)10(3)4/h9-12H,5-8H2,1-4H3 |
Asymmetric atoms | 1 |
LogP | 2.2026145 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Secondary amine, Tertiary amine, Amine (P+S+T), Diamine, 6-Membered heterocycle, Piperazine, Cyclic |