1-(1-Benzylpiperidin-4-yl)ethan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F683642 |
---|---|
Product Name | 1-(1-Benzylpiperidin-4-yl)ethan-1-amine |
CAS | 1308650-56-7 |
Purity | 95% |
Molecular weight | 218.344 |
IUPAC Name | 1-(1-benzylpiperidin-4-yl)ethan-1-amine |
SMILES | CC(N)C1CCN(CC2=CC=CC=C2)CC1 |
INCHI Code | InChI=1/C14H22N2/c1-12(15)14-7-9-16(10-8-14)11-13-5-3-2-4-6-13/h2-6,12,14H,7-11,15H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.0029962 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5714286 |
Concept Codes | Phenyl, Heterocycle, Primary amine, Tertiary amine, Amine (P+S+T), NBenzyl, Diamine, 6-Membered heterocycle, Piperidine, Cyclic, Aromatic |