3-(3,4-Dimethoxyphenyl)butanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F683169 |
---|---|
Product Name | 3-(3,4-Dimethoxyphenyl)butanoic acid |
CAS | 27877-65-2 |
Purity | 98% |
Molecular weight | 224.256 |
IUPAC Name | 3-(3,4-dimethoxyphenyl)butanoic acid |
SMILES | COC1=CC=C(C=C1OC)C(C)CC(O)=O |
INCHI Code | InChI=1/C12H16O4/c1-8(6-12(13)14)9-4-5-10(15-2)11(7-9)16-3/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
Asymmetric atoms | 1 |
LogP | 2.0272393 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Carboxylic acid, Methoxy, Ether, Cyclic, Aromatic, Anisole |