1-(7-Chlorobenzofuran-2-yl)-2-methylpropan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F681854 |
---|---|
Product Name | 1-(7-Chlorobenzofuran-2-yl)-2-methylpropan-1-amine |
CAS | 1483827-59-3 |
Purity | 98% |
Molecular weight | 223.7 |
IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-2-methylpropan-1-amine |
SMILES | CC(C)C(N)C1=CC2=CC=CC(Cl)=C2O1 |
INCHI Code | InChI=1/C12H14ClNO/c1-7(2)11(14)10-6-8-4-3-5-9(13)12(8)15-10/h3-7,11H,14H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 3.0862536 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Chloro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Benzofuran, Cyclic, Aromatic |