2-(Tert-butoxy)-5-fluoroaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F681476 |
---|---|
Product Name | 2-(Tert-butoxy)-5-fluoroaniline |
Other Names | 2-tert-Butoxy-5-fluoroaniline |
CAS | 862594-16-9 |
Purity | 97% |
Molecular weight | 183.226 |
IUPAC Name | 2-(tert-butoxy)-5-fluoroaniline |
SMILES | CC(C)(C)OC1=C(N)C=C(F)C=C1 |
INCHI Code | InChI=1S/C10H14FNO/c1-10(2,3)13-9-5-4-7(11)6-8(9)12/h4-6H,12H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 2.1833103 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Ether, Primary amine, Amine (P+S+T), Fluoro, Halo, Disubstituted (3,4)- monofluorobenzene, Monofluorobenzene, Aniline, Cyclic, Aromatic |