(6-Amino-3,4-dihydroquinolin-1(2h)-yl)(thiophen-2-yl)methanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F680533 |
---|---|
Product Name | (6-Amino-3,4-dihydroquinolin-1(2h)-yl)(thiophen-2-yl)methanone |
CAS | 927966-12-9 |
Purity | 95% |
Molecular weight | 258.34 |
IUPAC Name | 1-(thiophene-2-carbonyl)-1,2,3,4-tetrahydroquinolin-6-amine |
SMILES | NC1=CC=C2N(CCCC2=C1)C(=O)C1=CC=CS1 |
INCHI Code | InChI=1S/C14H14N2OS/c15-11-5-6-12-10(9-11)3-1-7-16(12)14(17)13-4-2-8-18-13/h2,4-6,8-9H,1,3,7,15H2 |
Asymmetric atoms | 0 |
LogP | 2.4976094 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.21428572 |
Concept Codes | Heterocycle, Heteroaromatic, Amide, Primary amine, Amine (P+S+T), Sulfide, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Thiophene, Cyclic, Aromatic |